About 6-(2,3-dihydroxypropylsulfanyl)-3-hydroxy-1,3-dihydroindol-2-one
6-(2,3-dihydroxypropylsulfanyl)-3-hydroxy-1,3-dihydroindol-2-one (PubChem CID 79670282) has the molecular formula C11H13NO4S
and a molecular weight of 255.29 g/mol. Its IUPAC name is 6-(2,3-dihydroxypropylsulfanyl)-3-hydroxy-1,3-dihydroindol-2-one.
Molecular Properties
| Compound Name | 6-(2,3-dihydroxypropylsulfanyl)-3-hydroxy-1,3-dihydroindol-2-one |
| PubChem CID | 79670282 |
| Molecular Formula | C11H13NO4S |
| Molecular Weight | 255.29 g/mol |
| Exact Mass | 255.06 |
| IUPAC Name | 6-(2,3-dihydroxypropylsulfanyl)-3-hydroxy-1,3-dihydroindol-2-one |
| SMILES | O=C1Nc2cc(SCC(O)CO)ccc2C1O |
| InChI | InChI=1S/C11H13NO4S/c13-4-6(14)5-17-7-1-2-8-9(3-7)12-11(16)10(8)15/h1-3,6,10,13-15H,4-5H2,(H,12,16) |
| InChIKey | ZJIPVLTZYOGPNM-UHFFFAOYSA-N |
| XLogP | 0.12 |
| TPSA | 89.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.29 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 6-(2,3-dihydroxypropylsulfanyl)-3-hydroxy-1,3-dihydroindol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(2,3-dihydroxypropylsulfanyl)-3-hydroxy-1,3-dihydroindol-2-one?
The IUPAC name of 6-(2,3-dihydroxypropylsulfanyl)-3-hydroxy-1,3-dihydroindol-2-one (CID 79670282) is 6-(2,3-dihydroxypropylsulfanyl)-3-hydroxy-1,3-dihydroindol-2-one.
What is the SMILES notation for 6-(2,3-dihydroxypropylsulfanyl)-3-hydroxy-1,3-dihydroindol-2-one?
The canonical SMILES for 6-(2,3-dihydroxypropylsulfanyl)-3-hydroxy-1,3-dihydroindol-2-one is O=C1Nc2cc(SCC(O)CO)ccc2C1O.
What is the InChIKey of 6-(2,3-dihydroxypropylsulfanyl)-3-hydroxy-1,3-dihydroindol-2-one?
The InChIKey is ZJIPVLTZYOGPNM-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13NO4S/c13-4-6(14)5-17-7-1-2-8-9(3-7)12-11(16)10(8)15/h1-3,6,10,13-15H,4-5H2,(H,12,16).
What are the key properties of 6-(2,3-dihydroxypropylsulfanyl)-3-hydroxy-1,3-dihydroindol-2-one?
6-(2,3-dihydroxypropylsulfanyl)-3-hydroxy-1,3-dihydroindol-2-one has a molecular weight of 255.29 g/mol, XLogP of 0.12, 4 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(2,3-dihydroxypropylsulfanyl)-3-hydroxy-1,3-dihydroindol-2-one is sourced from PubChem (CID 79670282), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).