C16H21ClF2N2 — CID 63836263
2-(2-chloroethyl)-1-(3-ethylpentan-2-yl)-6,7-difluorobenzimidazole (PubChem CID 63836263) has the molecular formula C16H21ClF2N2 and a molecular weight of 314.81 g/mol. Its IUPAC name is 2-(2-chloroethyl)-1-(3-ethylpentan-2-yl)-6,7-difluorobenzimidazole.
| Compound Name | 2-(2-chloroethyl)-1-(3-ethylpentan-2-yl)-6,7-difluorobenzimidazole |
|---|---|
| PubChem CID | 63836263 |
| Molecular Formula | C16H21ClF2N2 |
| Molecular Weight | 314.81 g/mol |
| Exact Mass | 314.14 |
| IUPAC Name | 2-(2-chloroethyl)-1-(3-ethylpentan-2-yl)-6,7-difluorobenzimidazole |
| SMILES | CCC(CC)C(C)n1c(CCCl)nc2ccc(F)c(F)c21 |
| InChI | InChI=1S/C16H21ClF2N2/c1-4-11(5-2)10(3)21-14(8-9-17)20-13-7-6-12(18)15(19)16(13)21/h6-7,10-11H,4-5,8-9H2,1-3H3 |
| InChIKey | VVATWKVIRVLCOR-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.81 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|