C9H15ClN2O2S2 — CID 63836299
3-chloro-N-methyl-N-[(4-methyl-1,3-thiazol-5-yl)methyl]propane-1-sulfonamide (PubChem CID 63836299) has the molecular formula C9H15ClN2O2S2 and a molecular weight of 282.82 g/mol. Its IUPAC name is 3-chloro-N-methyl-N-[(4-methyl-1,3-thiazol-5-yl)methyl]propane-1-sulfonamide.
| Compound Name | 3-chloro-N-methyl-N-[(4-methyl-1,3-thiazol-5-yl)methyl]propane-1-sulfonamide |
|---|---|
| PubChem CID | 63836299 |
| Molecular Formula | C9H15ClN2O2S2 |
| Molecular Weight | 282.82 g/mol |
| Exact Mass | 282.03 |
| IUPAC Name | 3-chloro-N-methyl-N-[(4-methyl-1,3-thiazol-5-yl)methyl]propane-1-sulfonamide |
| SMILES | Cc1ncsc1CN(C)S(=O)(=O)CCCCl |
| InChI | InChI=1S/C9H15ClN2O2S2/c1-8-9(15-7-11-8)6-12(2)16(13,14)5-3-4-10/h7H,3-6H2,1-2H3 |
| InChIKey | ARLIISLJLDVTHZ-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.82 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|