C10H17ClN2O2S2 — CID 79585000
3-chloro-N,2-dimethyl-N-[(4-methyl-1,3-thiazol-5-yl)methyl]propane-1-sulfonamide (PubChem CID 79585000) has the molecular formula C10H17ClN2O2S2 and a molecular weight of 296.85 g/mol. Its IUPAC name is 3-chloro-N,2-dimethyl-N-[(4-methyl-1,3-thiazol-5-yl)methyl]propane-1-sulfonamide.
| Compound Name | 3-chloro-N,2-dimethyl-N-[(4-methyl-1,3-thiazol-5-yl)methyl]propane-1-sulfonamide |
|---|---|
| PubChem CID | 79585000 |
| Molecular Formula | C10H17ClN2O2S2 |
| Molecular Weight | 296.85 g/mol |
| Exact Mass | 296.04 |
| IUPAC Name | 3-chloro-N,2-dimethyl-N-[(4-methyl-1,3-thiazol-5-yl)methyl]propane-1-sulfonamide |
| SMILES | Cc1ncsc1CN(C)S(=O)(=O)CC(C)CCl |
| InChI | InChI=1S/C10H17ClN2O2S2/c1-8(4-11)6-17(14,15)13(3)5-10-9(2)12-7-16-10/h7-8H,4-6H2,1-3H3 |
| InChIKey | ANEVLZFAJZMZPU-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.85 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|