C15H24ClNO2S — CID 79580904
3-chloro-N,2-dimethyl-N-[(4-propan-2-ylphenyl)methyl]propane-1-sulfonamide (PubChem CID 79580904) has the molecular formula C15H24ClNO2S and a molecular weight of 317.88 g/mol. Its IUPAC name is 3-chloro-N,2-dimethyl-N-[(4-propan-2-ylphenyl)methyl]propane-1-sulfonamide.
| Compound Name | 3-chloro-N,2-dimethyl-N-[(4-propan-2-ylphenyl)methyl]propane-1-sulfonamide |
|---|---|
| PubChem CID | 79580904 |
| Molecular Formula | C15H24ClNO2S |
| Molecular Weight | 317.88 g/mol |
| Exact Mass | 317.12 |
| IUPAC Name | 3-chloro-N,2-dimethyl-N-[(4-propan-2-ylphenyl)methyl]propane-1-sulfonamide |
| SMILES | CC(CCl)CS(=O)(=O)N(C)Cc1ccc(C(C)C)cc1 |
| InChI | InChI=1S/C15H24ClNO2S/c1-12(2)15-7-5-14(6-8-15)10-17(4)20(18,19)11-13(3)9-16/h5-8,12-13H,9-11H2,1-4H3 |
| InChIKey | LTZJEFGEDLRLSR-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.88 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|