C10H15N3 — CID 63839800
4-methyl-N'-propylpyridine-2-carboximidamide (PubChem CID 63839800) has the molecular formula C10H15N3 and a molecular weight of 177.25 g/mol. Its IUPAC name is 4-methyl-N'-propylpyridine-2-carboximidamide.
| Compound Name | 4-methyl-N'-propylpyridine-2-carboximidamide |
|---|---|
| PubChem CID | 63839800 |
| Molecular Formula | C10H15N3 |
| Molecular Weight | 177.25 g/mol |
| Exact Mass | 177.13 |
| IUPAC Name | 4-methyl-N'-propylpyridine-2-carboximidamide |
| SMILES | CCC/N=C(\N)c1cc(C)ccn1 |
| InChI | InChI=1S/C10H15N3/c1-3-5-13-10(11)9-7-8(2)4-6-12-9/h4,6-7H,3,5H2,1-2H3,(H2,11,13) |
| InChIKey | WDFBLWQWXTXCTM-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 51.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.25 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|