C13H22O2 — CID 6384065
(4E,8E)-12-methoxycyclododeca-4,8-dien-1-ol (PubChem CID 6384065) has the molecular formula C13H22O2 and a molecular weight of 210.32 g/mol. Its IUPAC name is (4E,8E)-12-methoxycyclododeca-4,8-dien-1-ol.
| Compound Name | (4E,8E)-12-methoxycyclododeca-4,8-dien-1-ol |
|---|---|
| PubChem CID | 6384065 |
| Molecular Formula | C13H22O2 |
| Molecular Weight | 210.32 g/mol |
| Exact Mass | 210.16 |
| IUPAC Name | (4E,8E)-12-methoxycyclododeca-4,8-dien-1-ol |
| SMILES | COC1CC/C=C/CC/C=C/CCC1O |
| InChI | InChI=1S/C13H22O2/c1-15-13-11-9-7-5-3-2-4-6-8-10-12(13)14/h4-7,12-14H,2-3,8-11H2,1H3/b6-4+,7-5+ |
| InChIKey | NZJRBFVCZFRVNJ-YDFGWWAZSA-N |
| XLogP | 2.83 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.32 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|