C18H23N3O2 — CID 638469
[(2S)-2-(anilinomethyl)pyrrolidin-1-yl]-[(1R,4S)-2-oxa-3-azabicyclo[2.2.2]oct-5-en-3-yl]methanone (PubChem CID 638469) has the molecular formula C18H23N3O2 and a molecular weight of 313.40 g/mol. Its IUPAC name is [(2S)-2-(anilinomethyl)pyrrolidin-1-yl]-[(1R,4S)-2-oxa-3-azabicyclo[2.2.2]oct-5-en-3-yl]methanone.
| Compound Name | [(2S)-2-(anilinomethyl)pyrrolidin-1-yl]-[(1R,4S)-2-oxa-3-azabicyclo[2.2.2]oct-5-en-3-yl]methanone |
|---|---|
| PubChem CID | 638469 |
| Molecular Formula | C18H23N3O2 |
| Molecular Weight | 313.40 g/mol |
| Exact Mass | 313.18 |
| IUPAC Name | [(2S)-2-(anilinomethyl)pyrrolidin-1-yl]-[(1R,4S)-2-oxa-3-azabicyclo[2.2.2]oct-5-en-3-yl]methanone |
| SMILES | O=C(N1CCC[C@H]1CNc1ccccc1)N1O[C@H]2C=C[C@@H]1CC2 |
| InChI | InChI=1S/C18H23N3O2/c22-18(21-15-8-10-17(23-21)11-9-15)20-12-4-7-16(20)13-19-14-5-2-1-3-6-14/h1-3,5-6,8,10,15-17,19H,4,7,9,11-13H2/t15-,16+,17+/m1/s1 |
| InChIKey | PRCLLTBPXZRVKA-IKGGRYGDSA-N |
| XLogP | 3.02 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.40 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|