C11H15NO2 — CID 102849692
N-(1,3-dioxan-2-ylmethyl)aniline (PubChem CID 102849692) has the molecular formula C11H15NO2 and a molecular weight of 193.25 g/mol. Its IUPAC name is N-(1,3-dioxan-2-ylmethyl)aniline.
| Compound Name | N-(1,3-dioxan-2-ylmethyl)aniline |
|---|---|
| PubChem CID | 102849692 |
| Molecular Formula | C11H15NO2 |
| Molecular Weight | 193.25 g/mol |
| Exact Mass | 193.11 |
| IUPAC Name | N-(1,3-dioxan-2-ylmethyl)aniline |
| SMILES | c1ccc(NCC2OCCCO2)cc1 |
| InChI | InChI=1S/C11H15NO2/c1-2-5-10(6-3-1)12-9-11-13-7-4-8-14-11/h1-3,5-6,11-12H,4,7-9H2 |
| InChIKey | HQMAITMCNNAEBF-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.25 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |