C15H21N — CID 66837373
N-[[(4Z)-cyclooct-4-en-1-yl]methyl]aniline (PubChem CID 66837373) has the molecular formula C15H21N and a molecular weight of 215.34 g/mol. Its IUPAC name is N-[[(4Z)-cyclooct-4-en-1-yl]methyl]aniline.
| Compound Name | N-[[(4Z)-cyclooct-4-en-1-yl]methyl]aniline |
|---|---|
| PubChem CID | 66837373 |
| Molecular Formula | C15H21N |
| Molecular Weight | 215.34 g/mol |
| Exact Mass | 215.17 |
| IUPAC Name | N-[[(4Z)-cyclooct-4-en-1-yl]methyl]aniline |
| SMILES | C1=C\CCC(CNc2ccccc2)CCC/1 |
| InChI | InChI=1S/C15H21N/c1-2-5-9-14(10-6-3-1)13-16-15-11-7-4-8-12-15/h1-2,4,7-8,11-12,14,16H,3,5-6,9-10,13H2/b2-1- |
| InChIKey | DTMNSXKOEQMVJN-UPHRSURJSA-N |
| XLogP | 4.24 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.34 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|