C14H18N2O4S — CID 63850228
N-cyclobutyl-6-sulfamoyl-3,4-dihydro-2H-chromene-3-carboxamide (PubChem CID 63850228) has the molecular formula C14H18N2O4S and a molecular weight of 310.38 g/mol. Its IUPAC name is N-cyclobutyl-6-sulfamoyl-3,4-dihydro-2H-chromene-3-carboxamide.
| Compound Name | N-cyclobutyl-6-sulfamoyl-3,4-dihydro-2H-chromene-3-carboxamide |
|---|---|
| PubChem CID | 63850228 |
| Molecular Formula | C14H18N2O4S |
| Molecular Weight | 310.38 g/mol |
| Exact Mass | 310.10 |
| IUPAC Name | N-cyclobutyl-6-sulfamoyl-3,4-dihydro-2H-chromene-3-carboxamide |
| SMILES | NS(=O)(=O)c1ccc2c(c1)CC(C(=O)NC1CCC1)CO2 |
| InChI | InChI=1S/C14H18N2O4S/c15-21(18,19)12-4-5-13-9(7-12)6-10(8-20-13)14(17)16-11-2-1-3-11/h4-5,7,10-11H,1-3,6,8H2,(H,16,17)(H2,15,18,19) |
| InChIKey | DOQNYBTXRRKIEV-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.38 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |