C10H13NO4 — CID 63851857
5-(2-hydroxy-2-methylpropoxy)pyridine-3-carboxylic acid (PubChem CID 63851857) has the molecular formula C10H13NO4 and a molecular weight of 211.22 g/mol. Its IUPAC name is 5-(2-hydroxy-2-methylpropoxy)pyridine-3-carboxylic acid.
| Compound Name | 5-(2-hydroxy-2-methylpropoxy)pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 63851857 |
| Molecular Formula | C10H13NO4 |
| Molecular Weight | 211.22 g/mol |
| Exact Mass | 211.08 |
| IUPAC Name | 5-(2-hydroxy-2-methylpropoxy)pyridine-3-carboxylic acid |
| SMILES | CC(C)(O)COc1cncc(C(=O)O)c1 |
| InChI | InChI=1S/C10H13NO4/c1-10(2,14)6-15-8-3-7(9(12)13)4-11-5-8/h3-5,14H,6H2,1-2H3,(H,12,13) |
| InChIKey | PFUWZQWIXDTKDV-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 79.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.22 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |