5-(5-hydroxypentoxy)pyridine-3-carboxylic acid

C11H15NO4 — CID 63851859

IUPAC5-(5-hydroxypentoxy)pyridine-3-carboxylic acid
SMILESO=C(O)c1cncc(OCCCCCO)c1
InChIInChI=1S/C11H15NO4/c13-4-2-1-3-5-16-10-6-9(11(14)15)7-12-8-10/h6-8,13H,1-5H2,(H,14,15)
InChIKeySSIBYRGSWNASNU-UHFFFAOYSA-N
MW225.24 g/mol
LogP1.32
Rot. Bonds7

About 5-(5-hydroxypentoxy)pyridine-3-carboxylic acid

5-(5-hydroxypentoxy)pyridine-3-carboxylic acid (PubChem CID 63851859) has the molecular formula C11H15NO4 and a molecular weight of 225.24 g/mol. Its IUPAC name is 5-(5-hydroxypentoxy)pyridine-3-carboxylic acid.

Molecular Properties

Compound Name5-(5-hydroxypentoxy)pyridine-3-carboxylic acid
PubChem CID63851859
Molecular FormulaC11H15NO4
Molecular Weight225.24 g/mol
Exact Mass225.10
IUPAC Name5-(5-hydroxypentoxy)pyridine-3-carboxylic acid
SMILESO=C(O)c1cncc(OCCCCCO)c1
InChIInChI=1S/C11H15NO4/c13-4-2-1-3-5-16-10-6-9(11(14)15)7-12-8-10/h6-8,13H,1-5H2,(H,14,15)
InChIKeySSIBYRGSWNASNU-UHFFFAOYSA-N
XLogP1.32
TPSA79.65 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds7
Heavy Atoms16
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500225.24
LogP ≤ 51.32
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze 5-(5-hydroxypentoxy)pyridine-3-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

5-hexoxypyridine-3-carboxylic acid
CID 63850317
5-(4-methoxybutoxy)pyridine-3-carboxylic acid
CID 104646807
5-butoxypyridine-3-carboxylic acid
CID 63851154
5-(3,3,3-trifluoropropoxy)pyridine-3-carboxylic acid
CID 64553523
5-[3-(4-chlorophenoxy)propoxy]pyridine-3-carboxylic acid
CID 63852389
5-[2-(dimethylamino)ethoxy]pyridine-3-carboxylic acid
CID 4738593
5-[4-(dimethylamino)-4-oxobutoxy]pyridine-3-carboxylic acid
CID 63852203
5-[2-(4-methoxyphenoxy)ethoxy]pyridine-3-carboxylic acid
CID 63851505
5-(2-pyridin-4-ylethoxy)pyridine-3-carboxylic acid
CID 55256220
4-(4-hydroxybutoxy)benzoic acid
CID 15218596
4-hydroxy-1-(5-propoxy-3-pyridinyl)butan-1-one
CID 106677594
5-(2-hydroxy-2-methylpropoxy)pyridine-3-carboxylic acid
CID 63851857

Frequently Asked Questions

What is the IUPAC name of 5-(5-hydroxypentoxy)pyridine-3-carboxylic acid?
The IUPAC name of 5-(5-hydroxypentoxy)pyridine-3-carboxylic acid (CID 63851859) is 5-(5-hydroxypentoxy)pyridine-3-carboxylic acid.
What is the SMILES notation for 5-(5-hydroxypentoxy)pyridine-3-carboxylic acid?
The canonical SMILES for 5-(5-hydroxypentoxy)pyridine-3-carboxylic acid is O=C(O)c1cncc(OCCCCCO)c1.
What is the InChIKey of 5-(5-hydroxypentoxy)pyridine-3-carboxylic acid?
The InChIKey is SSIBYRGSWNASNU-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15NO4/c13-4-2-1-3-5-16-10-6-9(11(14)15)7-12-8-10/h6-8,13H,1-5H2,(H,14,15).
What are the key properties of 5-(5-hydroxypentoxy)pyridine-3-carboxylic acid?
5-(5-hydroxypentoxy)pyridine-3-carboxylic acid has a molecular weight of 225.24 g/mol, XLogP of 1.32, 7 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(5-hydroxypentoxy)pyridine-3-carboxylic acid is sourced from PubChem (CID 63851859), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).