C12H21NO2S — CID 63857447
1-(furan-2-yl)-N-[2-(3-methoxypropylsulfanyl)ethyl]ethanamine (PubChem CID 63857447) has the molecular formula C12H21NO2S and a molecular weight of 243.37 g/mol. Its IUPAC name is 1-(furan-2-yl)-N-[2-(3-methoxypropylsulfanyl)ethyl]ethanamine.
| Compound Name | 1-(furan-2-yl)-N-[2-(3-methoxypropylsulfanyl)ethyl]ethanamine |
|---|---|
| PubChem CID | 63857447 |
| Molecular Formula | C12H21NO2S |
| Molecular Weight | 243.37 g/mol |
| Exact Mass | 243.13 |
| IUPAC Name | 1-(furan-2-yl)-N-[2-(3-methoxypropylsulfanyl)ethyl]ethanamine |
| SMILES | COCCCSCCNC(C)c1ccco1 |
| InChI | InChI=1S/C12H21NO2S/c1-11(12-5-3-8-15-12)13-6-10-16-9-4-7-14-2/h3,5,8,11,13H,4,6-7,9-10H2,1-2H3 |
| InChIKey | CBPFMLLWXFIKBU-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 34.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.37 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|