C10H17BrN2O2S2 — CID 63859642
N-[1-[(5-bromothiophen-2-yl)methylamino]-2-methylpropan-2-yl]methanesulfonamide (PubChem CID 63859642) has the molecular formula C10H17BrN2O2S2 and a molecular weight of 341.30 g/mol. Its IUPAC name is N-[1-[(5-bromothiophen-2-yl)methylamino]-2-methylpropan-2-yl]methanesulfonamide.
| Compound Name | N-[1-[(5-bromothiophen-2-yl)methylamino]-2-methylpropan-2-yl]methanesulfonamide |
|---|---|
| PubChem CID | 63859642 |
| Molecular Formula | C10H17BrN2O2S2 |
| Molecular Weight | 341.30 g/mol |
| Exact Mass | 339.99 |
| IUPAC Name | N-[1-[(5-bromothiophen-2-yl)methylamino]-2-methylpropan-2-yl]methanesulfonamide |
| SMILES | CC(C)(CNCc1ccc(Br)s1)NS(C)(=O)=O |
| InChI | InChI=1S/C10H17BrN2O2S2/c1-10(2,13-17(3,14)15)7-12-6-8-4-5-9(11)16-8/h4-5,12-13H,6-7H2,1-3H3 |
| InChIKey | KMPWVRQVNXVXBY-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.30 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |