C14H23NS — CID 63861303
1-(2-ethylcyclohexyl)-2-thiophen-2-ylethanamine (PubChem CID 63861303) has the molecular formula C14H23NS and a molecular weight of 237.41 g/mol. Its IUPAC name is 1-(2-ethylcyclohexyl)-2-thiophen-2-ylethanamine.
| Compound Name | 1-(2-ethylcyclohexyl)-2-thiophen-2-ylethanamine |
|---|---|
| PubChem CID | 63861303 |
| Molecular Formula | C14H23NS |
| Molecular Weight | 237.41 g/mol |
| Exact Mass | 237.16 |
| IUPAC Name | 1-(2-ethylcyclohexyl)-2-thiophen-2-ylethanamine |
| SMILES | CCC1CCCCC1C(N)Cc1cccs1 |
| InChI | InChI=1S/C14H23NS/c1-2-11-6-3-4-8-13(11)14(15)10-12-7-5-9-16-12/h5,7,9,11,13-14H,2-4,6,8,10,15H2,1H3 |
| InChIKey | FOVAIVFWPMKDIO-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.41 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |