C16H23F2N — CID 63862912
2-(3,5-difluorophenyl)-1-(2-ethylcyclohexyl)ethanamine (PubChem CID 63862912) has the molecular formula C16H23F2N and a molecular weight of 267.36 g/mol. Its IUPAC name is 2-(3,5-difluorophenyl)-1-(2-ethylcyclohexyl)ethanamine.
| Compound Name | 2-(3,5-difluorophenyl)-1-(2-ethylcyclohexyl)ethanamine |
|---|---|
| PubChem CID | 63862912 |
| Molecular Formula | C16H23F2N |
| Molecular Weight | 267.36 g/mol |
| Exact Mass | 267.18 |
| IUPAC Name | 2-(3,5-difluorophenyl)-1-(2-ethylcyclohexyl)ethanamine |
| SMILES | CCC1CCCCC1C(N)Cc1cc(F)cc(F)c1 |
| InChI | InChI=1S/C16H23F2N/c1-2-12-5-3-4-6-15(12)16(19)9-11-7-13(17)10-14(18)8-11/h7-8,10,12,15-16H,2-6,9,19H2,1H3 |
| InChIKey | RVNVTRXDSUSNNC-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.36 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |