C10H11F2NO — CID 86587041
(1S)-2-(3,5-difluorophenyl)-1-[(2S)-oxiran-2-yl]ethanamine (PubChem CID 86587041) has the molecular formula C10H11F2NO and a molecular weight of 199.20 g/mol. Its IUPAC name is (1S)-2-(3,5-difluorophenyl)-1-[(2S)-oxiran-2-yl]ethanamine.
| Compound Name | (1S)-2-(3,5-difluorophenyl)-1-[(2S)-oxiran-2-yl]ethanamine |
|---|---|
| PubChem CID | 86587041 |
| Molecular Formula | C10H11F2NO |
| Molecular Weight | 199.20 g/mol |
| Exact Mass | 199.08 |
| IUPAC Name | (1S)-2-(3,5-difluorophenyl)-1-[(2S)-oxiran-2-yl]ethanamine |
| SMILES | N[C@@H](Cc1cc(F)cc(F)c1)[C@H]1CO1 |
| InChI | InChI=1S/C10H11F2NO/c11-7-1-6(2-8(12)4-7)3-9(13)10-5-14-10/h1-2,4,9-10H,3,5,13H2/t9-,10+/m0/s1 |
| InChIKey | QNLJZHVCGHSLIJ-VHSXEESVSA-N |
| XLogP | 1.23 |
| TPSA | 38.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.20 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|