C19H17NO4S3 — CID 6386813
[4-[(E)-[3-(3-methoxypropyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]phenyl] thiophene-2-carboxylate (PubChem CID 6386813) has the molecular formula C19H17NO4S3 and a molecular weight of 419.55 g/mol. Its IUPAC name is [4-[(E)-[3-(3-methoxypropyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]phenyl] thiophene-2-carboxylate.
| Compound Name | [4-[(E)-[3-(3-methoxypropyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]phenyl] thiophene-2-carboxylate |
|---|---|
| PubChem CID | 6386813 |
| Molecular Formula | C19H17NO4S3 |
| Molecular Weight | 419.55 g/mol |
| Exact Mass | 419.03 |
| IUPAC Name | [4-[(E)-[3-(3-methoxypropyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]phenyl] thiophene-2-carboxylate |
| SMILES | COCCCN1C(=O)/C(=C\c2ccc(OC(=O)c3cccs3)cc2)SC1=S |
| InChI | InChI=1S/C19H17NO4S3/c1-23-10-3-9-20-17(21)16(27-19(20)25)12-13-5-7-14(8-6-13)24-18(22)15-4-2-11-26-15/h2,4-8,11-12H,3,9-10H2,1H3/b16-12+ |
| InChIKey | FZNPUSLAZWAXSK-FOWTUZBSSA-N |
| XLogP | 4.20 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.55 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|