C8H8N4S — CID 63868841
4-methyl-6-thiophen-3-yl-1,3,5-triazin-2-amine (PubChem CID 63868841) has the molecular formula C8H8N4S and a molecular weight of 192.25 g/mol. Its IUPAC name is 4-methyl-6-thiophen-3-yl-1,3,5-triazin-2-amine.
| Compound Name | 4-methyl-6-thiophen-3-yl-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 63868841 |
| Molecular Formula | C8H8N4S |
| Molecular Weight | 192.25 g/mol |
| Exact Mass | 192.05 |
| IUPAC Name | 4-methyl-6-thiophen-3-yl-1,3,5-triazin-2-amine |
| SMILES | Cc1nc(N)nc(-c2ccsc2)n1 |
| InChI | InChI=1S/C8H8N4S/c1-5-10-7(12-8(9)11-5)6-2-3-13-4-6/h2-4H,1H3,(H2,9,10,11,12) |
| InChIKey | YINSZKUIDQUEFT-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 64.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.25 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |