C12H14BrNO5 — CID 63869212
2-[1-(5-bromofuran-2-carbonyl)piperidin-4-yl]oxyacetic acid (PubChem CID 63869212) has the molecular formula C12H14BrNO5 and a molecular weight of 332.15 g/mol. Its IUPAC name is 2-[1-(5-bromofuran-2-carbonyl)piperidin-4-yl]oxyacetic acid.
| Compound Name | 2-[1-(5-bromofuran-2-carbonyl)piperidin-4-yl]oxyacetic acid |
|---|---|
| PubChem CID | 63869212 |
| Molecular Formula | C12H14BrNO5 |
| Molecular Weight | 332.15 g/mol |
| Exact Mass | 331.01 |
| IUPAC Name | 2-[1-(5-bromofuran-2-carbonyl)piperidin-4-yl]oxyacetic acid |
| SMILES | O=C(O)COC1CCN(C(=O)c2ccc(Br)o2)CC1 |
| InChI | InChI=1S/C12H14BrNO5/c13-10-2-1-9(19-10)12(17)14-5-3-8(4-6-14)18-7-11(15)16/h1-2,8H,3-7H2,(H,15,16) |
| InChIKey | ZMWGLGNDIQGFCH-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 79.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.15 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |