C9H17F3N2O3S — CID 63869486
1,1,1-trifluoro-N-(3-piperidin-4-yloxypropyl)methanesulfonamide (PubChem CID 63869486) has the molecular formula C9H17F3N2O3S and a molecular weight of 290.31 g/mol. Its IUPAC name is 1,1,1-trifluoro-N-(3-piperidin-4-yloxypropyl)methanesulfonamide.
| Compound Name | 1,1,1-trifluoro-N-(3-piperidin-4-yloxypropyl)methanesulfonamide |
|---|---|
| PubChem CID | 63869486 |
| Molecular Formula | C9H17F3N2O3S |
| Molecular Weight | 290.31 g/mol |
| Exact Mass | 290.09 |
| IUPAC Name | 1,1,1-trifluoro-N-(3-piperidin-4-yloxypropyl)methanesulfonamide |
| SMILES | O=S(=O)(NCCCOC1CCNCC1)C(F)(F)F |
| InChI | InChI=1S/C9H17F3N2O3S/c10-9(11,12)18(15,16)14-4-1-7-17-8-2-5-13-6-3-8/h8,13-14H,1-7H2 |
| InChIKey | ZOJIGUHUMNMFJH-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.31 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|