C13H20N4O3 — CID 63869519
N-[2-(4-aminocyclohexyl)oxyethyl]-6-nitropyridin-3-amine (PubChem CID 63869519) has the molecular formula C13H20N4O3 and a molecular weight of 280.33 g/mol. Its IUPAC name is N-[2-(4-aminocyclohexyl)oxyethyl]-6-nitropyridin-3-amine.
| Compound Name | N-[2-(4-aminocyclohexyl)oxyethyl]-6-nitropyridin-3-amine |
|---|---|
| PubChem CID | 63869519 |
| Molecular Formula | C13H20N4O3 |
| Molecular Weight | 280.33 g/mol |
| Exact Mass | 280.15 |
| IUPAC Name | N-[2-(4-aminocyclohexyl)oxyethyl]-6-nitropyridin-3-amine |
| SMILES | NC1CCC(OCCNc2ccc([N+](=O)[O-])nc2)CC1 |
| InChI | InChI=1S/C13H20N4O3/c14-10-1-4-12(5-2-10)20-8-7-15-11-3-6-13(16-9-11)17(18)19/h3,6,9-10,12,15H,1-2,4-5,7-8,14H2 |
| InChIKey | UNLKDSHEEDDNIH-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 103.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.33 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|