C16H25N3O2 — CID 63870027
2-[2-(4-aminocyclohexyl)oxyethylamino]-4-methylbenzamide (PubChem CID 63870027) has the molecular formula C16H25N3O2 and a molecular weight of 291.39 g/mol. Its IUPAC name is 2-[2-(4-aminocyclohexyl)oxyethylamino]-4-methylbenzamide.
| Compound Name | 2-[2-(4-aminocyclohexyl)oxyethylamino]-4-methylbenzamide |
|---|---|
| PubChem CID | 63870027 |
| Molecular Formula | C16H25N3O2 |
| Molecular Weight | 291.39 g/mol |
| Exact Mass | 291.19 |
| IUPAC Name | 2-[2-(4-aminocyclohexyl)oxyethylamino]-4-methylbenzamide |
| SMILES | Cc1ccc(C(N)=O)c(NCCOC2CCC(N)CC2)c1 |
| InChI | InChI=1S/C16H25N3O2/c1-11-2-7-14(16(18)20)15(10-11)19-8-9-21-13-5-3-12(17)4-6-13/h2,7,10,12-13,19H,3-6,8-9,17H2,1H3,(H2,18,20) |
| InChIKey | XMHKSHGHYYOXHL-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 90.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.39 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|