C16H24N2O2 — CID 638702
[(1S,3R,9aR)-3-(6-methoxy-2-pyridinyl)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methanol (PubChem CID 638702) has the molecular formula C16H24N2O2 and a molecular weight of 276.38 g/mol. Its IUPAC name is [(1S,3R,9aR)-3-(6-methoxy-2-pyridinyl)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methanol.
| Compound Name | [(1S,3R,9aR)-3-(6-methoxy-2-pyridinyl)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methanol |
|---|---|
| PubChem CID | 638702 |
| Molecular Formula | C16H24N2O2 |
| Molecular Weight | 276.38 g/mol |
| Exact Mass | 276.18 |
| IUPAC Name | [(1S,3R,9aR)-3-(6-methoxy-2-pyridinyl)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methanol |
| SMILES | COc1cccc([C@@H]2C[C@H](CO)[C@H]3CCCCN3C2)n1 |
| InChI | InChI=1S/C16H24N2O2/c1-20-16-7-4-5-14(17-16)12-9-13(11-19)15-6-2-3-8-18(15)10-12/h4-5,7,12-13,15,19H,2-3,6,8-11H2,1H3/t12-,13-,15-/m1/s1 |
| InChIKey | PLGJKFRJCOWWMU-UMVBOHGHSA-N |
| XLogP | 2.04 |
| TPSA | 45.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.38 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |