C16H24N2O3 — CID 638704
(3S,7R,9S,9aR)-9-(hydroxymethyl)-7-(6-methoxy-2-pyridinyl)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-3-ol (PubChem CID 638704) has the molecular formula C16H24N2O3 and a molecular weight of 292.38 g/mol. Its IUPAC name is (3S,7R,9S,9aR)-9-(hydroxymethyl)-7-(6-methoxy-2-pyridinyl)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-3-ol.
| Compound Name | (3S,7R,9S,9aR)-9-(hydroxymethyl)-7-(6-methoxy-2-pyridinyl)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-3-ol |
|---|---|
| PubChem CID | 638704 |
| Molecular Formula | C16H24N2O3 |
| Molecular Weight | 292.38 g/mol |
| Exact Mass | 292.18 |
| IUPAC Name | (3S,7R,9S,9aR)-9-(hydroxymethyl)-7-(6-methoxy-2-pyridinyl)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-3-ol |
| SMILES | COc1cccc([C@@H]2C[C@H](CO)[C@H]3CC[C@H](O)CN3C2)n1 |
| InChI | InChI=1S/C16H24N2O3/c1-21-16-4-2-3-14(17-16)11-7-12(10-19)15-6-5-13(20)9-18(15)8-11/h2-4,11-13,15,19-20H,5-10H2,1H3/t11-,12-,13+,15-/m1/s1 |
| InChIKey | WUPLEXBYYUOWQF-GUIRCDHDSA-N |
| XLogP | 1.01 |
| TPSA | 65.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.38 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |