C9H12BrN3O2S — CID 63874579
5-bromo-N-(1,1-dioxothiolan-3-yl)-N-methylpyrimidin-2-amine (PubChem CID 63874579) has the molecular formula C9H12BrN3O2S and a molecular weight of 306.19 g/mol. Its IUPAC name is 5-bromo-N-(1,1-dioxothiolan-3-yl)-N-methylpyrimidin-2-amine.
| Compound Name | 5-bromo-N-(1,1-dioxothiolan-3-yl)-N-methylpyrimidin-2-amine |
|---|---|
| PubChem CID | 63874579 |
| Molecular Formula | C9H12BrN3O2S |
| Molecular Weight | 306.19 g/mol |
| Exact Mass | 304.98 |
| IUPAC Name | 5-bromo-N-(1,1-dioxothiolan-3-yl)-N-methylpyrimidin-2-amine |
| SMILES | CN(c1ncc(Br)cn1)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C9H12BrN3O2S/c1-13(8-2-3-16(14,15)6-8)9-11-4-7(10)5-12-9/h4-5,8H,2-3,6H2,1H3 |
| InChIKey | JDVZPAHAIYGAAJ-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 63.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.19 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |