C10H14ClN3O2S — CID 75377306
5-chloro-N-(1,1-dioxothian-4-yl)-N-methylpyrimidin-2-amine (PubChem CID 75377306) has the molecular formula C10H14ClN3O2S and a molecular weight of 275.76 g/mol. Its IUPAC name is 5-chloro-N-(1,1-dioxothian-4-yl)-N-methylpyrimidin-2-amine.
| Compound Name | 5-chloro-N-(1,1-dioxothian-4-yl)-N-methylpyrimidin-2-amine |
|---|---|
| PubChem CID | 75377306 |
| Molecular Formula | C10H14ClN3O2S |
| Molecular Weight | 275.76 g/mol |
| Exact Mass | 275.05 |
| IUPAC Name | 5-chloro-N-(1,1-dioxothian-4-yl)-N-methylpyrimidin-2-amine |
| SMILES | CN(c1ncc(Cl)cn1)C1CCS(=O)(=O)CC1 |
| InChI | InChI=1S/C10H14ClN3O2S/c1-14(10-12-6-8(11)7-13-10)9-2-4-17(15,16)5-3-9/h6-7,9H,2-5H2,1H3 |
| InChIKey | QIVYOJWBGXLAEU-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 63.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.76 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |