C11H13BrN4S — CID 63874771
N-(5-bromopyrimidin-2-yl)-4-tert-butyl-1,3-thiazol-2-amine (PubChem CID 63874771) has the molecular formula C11H13BrN4S and a molecular weight of 313.22 g/mol. Its IUPAC name is N-(5-bromopyrimidin-2-yl)-4-tert-butyl-1,3-thiazol-2-amine.
| Compound Name | N-(5-bromopyrimidin-2-yl)-4-tert-butyl-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 63874771 |
| Molecular Formula | C11H13BrN4S |
| Molecular Weight | 313.22 g/mol |
| Exact Mass | 312.00 |
| IUPAC Name | N-(5-bromopyrimidin-2-yl)-4-tert-butyl-1,3-thiazol-2-amine |
| SMILES | CC(C)(C)c1csc(Nc2ncc(Br)cn2)n1 |
| InChI | InChI=1S/C11H13BrN4S/c1-11(2,3)8-6-17-10(15-8)16-9-13-4-7(12)5-14-9/h4-6H,1-3H3,(H,13,14,15,16) |
| InChIKey | YEMFPNULWIUKER-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.22 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |