C13H13BrClN3OS — CID 62000856
5-bromo-N-(4-tert-butyl-1,3-thiazol-2-yl)-2-chloropyridine-3-carboxamide (PubChem CID 62000856) has the molecular formula C13H13BrClN3OS and a molecular weight of 374.69 g/mol. Its IUPAC name is 5-bromo-N-(4-tert-butyl-1,3-thiazol-2-yl)-2-chloropyridine-3-carboxamide.
| Compound Name | 5-bromo-N-(4-tert-butyl-1,3-thiazol-2-yl)-2-chloropyridine-3-carboxamide |
|---|---|
| PubChem CID | 62000856 |
| Molecular Formula | C13H13BrClN3OS |
| Molecular Weight | 374.69 g/mol |
| Exact Mass | 372.97 |
| IUPAC Name | 5-bromo-N-(4-tert-butyl-1,3-thiazol-2-yl)-2-chloropyridine-3-carboxamide |
| SMILES | CC(C)(C)c1csc(NC(=O)c2cc(Br)cnc2Cl)n1 |
| InChI | InChI=1S/C13H13BrClN3OS/c1-13(2,3)9-6-20-12(17-9)18-11(19)8-4-7(14)5-16-10(8)15/h4-6H,1-3H3,(H,17,18,19) |
| InChIKey | XVDDPRHFBPGXQI-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.69 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|