C14H23BrN2O2S2 — CID 63878266
N-[[1-(3-bromothiophen-2-yl)sulfonylpiperidin-2-yl]methyl]-2-methylpropan-1-amine (PubChem CID 63878266) has the molecular formula C14H23BrN2O2S2 and a molecular weight of 395.39 g/mol. Its IUPAC name is N-[[1-(3-bromothiophen-2-yl)sulfonylpiperidin-2-yl]methyl]-2-methylpropan-1-amine.
| Compound Name | N-[[1-(3-bromothiophen-2-yl)sulfonylpiperidin-2-yl]methyl]-2-methylpropan-1-amine |
|---|---|
| PubChem CID | 63878266 |
| Molecular Formula | C14H23BrN2O2S2 |
| Molecular Weight | 395.39 g/mol |
| Exact Mass | 394.04 |
| IUPAC Name | N-[[1-(3-bromothiophen-2-yl)sulfonylpiperidin-2-yl]methyl]-2-methylpropan-1-amine |
| SMILES | CC(C)CNCC1CCCCN1S(=O)(=O)c1sccc1Br |
| InChI | InChI=1S/C14H23BrN2O2S2/c1-11(2)9-16-10-12-5-3-4-7-17(12)21(18,19)14-13(15)6-8-20-14/h6,8,11-12,16H,3-5,7,9-10H2,1-2H3 |
| InChIKey | ZRDACBSBBBCZNT-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.39 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |