C27H22N2O2S2 — CID 6387982
N-benzyl-2-[(5Z)-4-oxo-5-[(E)-3-phenylprop-2-enylidene]-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-phenylacetamide (PubChem CID 6387982) has the molecular formula C27H22N2O2S2 and a molecular weight of 470.62 g/mol. Its IUPAC name is N-benzyl-2-[(5Z)-4-oxo-5-[(E)-3-phenylprop-2-enylidene]-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-phenylacetamide.
| Compound Name | N-benzyl-2-[(5Z)-4-oxo-5-[(E)-3-phenylprop-2-enylidene]-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-phenylacetamide |
|---|---|
| PubChem CID | 6387982 |
| Molecular Formula | C27H22N2O2S2 |
| Molecular Weight | 470.62 g/mol |
| Exact Mass | 470.11 |
| IUPAC Name | N-benzyl-2-[(5Z)-4-oxo-5-[(E)-3-phenylprop-2-enylidene]-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-phenylacetamide |
| SMILES | O=C1/C(=C/C=C/c2ccccc2)SC(=S)N1CC(=O)N(Cc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C27H22N2O2S2/c30-25(28(23-16-8-3-9-17-23)19-22-13-6-2-7-14-22)20-29-26(31)24(33-27(29)32)18-10-15-21-11-4-1-5-12-21/h1-18H,19-20H2/b15-10+,24-18- |
| InChIKey | FCPAOUZXJXOLNT-MQGABSPSSA-N |
| XLogP | 5.68 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.62 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|