C25H19ClN2O2S2 — CID 2894068
N-benzyl-2-[5-[(2-chlorophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-phenylacetamide (PubChem CID 2894068) has the molecular formula C25H19ClN2O2S2 and a molecular weight of 479.03 g/mol. Its IUPAC name is N-benzyl-2-[5-[(2-chlorophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-phenylacetamide.
| Compound Name | N-benzyl-2-[5-[(2-chlorophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-phenylacetamide |
|---|---|
| PubChem CID | 2894068 |
| Molecular Formula | C25H19ClN2O2S2 |
| Molecular Weight | 479.03 g/mol |
| Exact Mass | 478.06 |
| IUPAC Name | N-benzyl-2-[5-[(2-chlorophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-phenylacetamide |
| SMILES | O=C1C(=Cc2ccccc2Cl)SC(=S)N1CC(=O)N(Cc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C25H19ClN2O2S2/c26-21-14-8-7-11-19(21)15-22-24(30)28(25(31)32-22)17-23(29)27(20-12-5-2-6-13-20)16-18-9-3-1-4-10-18/h1-15H,16-17H2 |
| InChIKey | LCESUONCSOFAKQ-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.03 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|