C15H17N3O3 — CID 63885421
ethyl 3-[(4-carbamoylquinolin-2-yl)amino]propanoate (PubChem CID 63885421) has the molecular formula C15H17N3O3 and a molecular weight of 287.32 g/mol. Its IUPAC name is ethyl 3-[(4-carbamoylquinolin-2-yl)amino]propanoate.
| Compound Name | ethyl 3-[(4-carbamoylquinolin-2-yl)amino]propanoate |
|---|---|
| PubChem CID | 63885421 |
| Molecular Formula | C15H17N3O3 |
| Molecular Weight | 287.32 g/mol |
| Exact Mass | 287.13 |
| IUPAC Name | ethyl 3-[(4-carbamoylquinolin-2-yl)amino]propanoate |
| SMILES | CCOC(=O)CCNc1cc(C(N)=O)c2ccccc2n1 |
| InChI | InChI=1S/C15H17N3O3/c1-2-21-14(19)7-8-17-13-9-11(15(16)20)10-5-3-4-6-12(10)18-13/h3-6,9H,2,7-8H2,1H3,(H2,16,20)(H,17,18) |
| InChIKey | HKUCLYBJOFTOSY-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 94.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.32 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |