C12H21N3 — CID 63887639
N-[[2-(aminomethyl)-4-pyridinyl]methyl]-N-methylbutan-2-amine (PubChem CID 63887639) has the molecular formula C12H21N3 and a molecular weight of 207.32 g/mol. Its IUPAC name is N-[[2-(aminomethyl)-4-pyridinyl]methyl]-N-methylbutan-2-amine.
| Compound Name | N-[[2-(aminomethyl)-4-pyridinyl]methyl]-N-methylbutan-2-amine |
|---|---|
| PubChem CID | 63887639 |
| Molecular Formula | C12H21N3 |
| Molecular Weight | 207.32 g/mol |
| Exact Mass | 207.17 |
| IUPAC Name | N-[[2-(aminomethyl)-4-pyridinyl]methyl]-N-methylbutan-2-amine |
| SMILES | CCC(C)N(C)Cc1ccnc(CN)c1 |
| InChI | InChI=1S/C12H21N3/c1-4-10(2)15(3)9-11-5-6-14-12(7-11)8-13/h5-7,10H,4,8-9,13H2,1-3H3 |
| InChIKey | SRSLXQNZFMDVMK-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.32 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |