C10H17N3 — CID 170890841
1-[2-(aminomethyl)-4-pyridinyl]butan-2-amine (PubChem CID 170890841) has the molecular formula C10H17N3 and a molecular weight of 179.27 g/mol. Its IUPAC name is 1-[2-(aminomethyl)-4-pyridinyl]butan-2-amine.
| Compound Name | 1-[2-(aminomethyl)-4-pyridinyl]butan-2-amine |
|---|---|
| PubChem CID | 170890841 |
| Molecular Formula | C10H17N3 |
| Molecular Weight | 179.27 g/mol |
| Exact Mass | 179.14 |
| IUPAC Name | 1-[2-(aminomethyl)-4-pyridinyl]butan-2-amine |
| SMILES | CCC(N)Cc1ccnc(CN)c1 |
| InChI | InChI=1S/C10H17N3/c1-2-9(12)5-8-3-4-13-10(6-8)7-11/h3-4,6,9H,2,5,7,11-12H2,1H3 |
| InChIKey | UGEDXHGEFZIUAV-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 64.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.27 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |