C15H25N3O2 — CID 63896856
2-[[(1,4-dimethylpiperazin-2-yl)methylamino]methyl]-5-methoxyphenol (PubChem CID 63896856) has the molecular formula C15H25N3O2 and a molecular weight of 279.38 g/mol. Its IUPAC name is 2-[[(1,4-dimethylpiperazin-2-yl)methylamino]methyl]-5-methoxyphenol.
| Compound Name | 2-[[(1,4-dimethylpiperazin-2-yl)methylamino]methyl]-5-methoxyphenol |
|---|---|
| PubChem CID | 63896856 |
| Molecular Formula | C15H25N3O2 |
| Molecular Weight | 279.38 g/mol |
| Exact Mass | 279.19 |
| IUPAC Name | 2-[[(1,4-dimethylpiperazin-2-yl)methylamino]methyl]-5-methoxyphenol |
| SMILES | COc1ccc(CNCC2CN(C)CCN2C)c(O)c1 |
| InChI | InChI=1S/C15H25N3O2/c1-17-6-7-18(2)13(11-17)10-16-9-12-4-5-14(20-3)8-15(12)19/h4-5,8,13,16,19H,6-7,9-11H2,1-3H3 |
| InChIKey | CAFRYVXOULQDMI-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 47.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.38 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|