C16H27N3O2 — CID 63896297
2-[[(1,4-dimethylpiperazin-2-yl)methylamino]methyl]-6-ethoxyphenol (PubChem CID 63896297) has the molecular formula C16H27N3O2 and a molecular weight of 293.41 g/mol. Its IUPAC name is 2-[[(1,4-dimethylpiperazin-2-yl)methylamino]methyl]-6-ethoxyphenol.
| Compound Name | 2-[[(1,4-dimethylpiperazin-2-yl)methylamino]methyl]-6-ethoxyphenol |
|---|---|
| PubChem CID | 63896297 |
| Molecular Formula | C16H27N3O2 |
| Molecular Weight | 293.41 g/mol |
| Exact Mass | 293.21 |
| IUPAC Name | 2-[[(1,4-dimethylpiperazin-2-yl)methylamino]methyl]-6-ethoxyphenol |
| SMILES | CCOc1cccc(CNCC2CN(C)CCN2C)c1O |
| InChI | InChI=1S/C16H27N3O2/c1-4-21-15-7-5-6-13(16(15)20)10-17-11-14-12-18(2)8-9-19(14)3/h5-7,14,17,20H,4,8-12H2,1-3H3 |
| InChIKey | FAGDUGHSUJFAEC-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 47.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.41 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|