C13H24N2O3 — CID 63897382
ethyl 3-oxo-4-(3,3,4-trimethylpiperazin-1-yl)butanoate (PubChem CID 63897382) has the molecular formula C13H24N2O3 and a molecular weight of 256.35 g/mol. Its IUPAC name is ethyl 3-oxo-4-(3,3,4-trimethylpiperazin-1-yl)butanoate.
| Compound Name | ethyl 3-oxo-4-(3,3,4-trimethylpiperazin-1-yl)butanoate |
|---|---|
| PubChem CID | 63897382 |
| Molecular Formula | C13H24N2O3 |
| Molecular Weight | 256.35 g/mol |
| Exact Mass | 256.18 |
| IUPAC Name | ethyl 3-oxo-4-(3,3,4-trimethylpiperazin-1-yl)butanoate |
| SMILES | CCOC(=O)CC(=O)CN1CCN(C)C(C)(C)C1 |
| InChI | InChI=1S/C13H24N2O3/c1-5-18-12(17)8-11(16)9-15-7-6-14(4)13(2,3)10-15/h5-10H2,1-4H3 |
| InChIKey | YBSHAYOQDDWBNX-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.35 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|