C12H21NO4 — CID 63898681
ethyl 4-(2,2-dimethylmorpholin-4-yl)-3-oxobutanoate (PubChem CID 63898681) has the molecular formula C12H21NO4 and a molecular weight of 243.30 g/mol. Its IUPAC name is ethyl 4-(2,2-dimethylmorpholin-4-yl)-3-oxobutanoate.
| Compound Name | ethyl 4-(2,2-dimethylmorpholin-4-yl)-3-oxobutanoate |
|---|---|
| PubChem CID | 63898681 |
| Molecular Formula | C12H21NO4 |
| Molecular Weight | 243.30 g/mol |
| Exact Mass | 243.15 |
| IUPAC Name | ethyl 4-(2,2-dimethylmorpholin-4-yl)-3-oxobutanoate |
| SMILES | CCOC(=O)CC(=O)CN1CCOC(C)(C)C1 |
| InChI | InChI=1S/C12H21NO4/c1-4-16-11(15)7-10(14)8-13-5-6-17-12(2,3)9-13/h4-9H2,1-3H3 |
| InChIKey | HTLMHYZWUNTLNN-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.30 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|