C12H20N2O4 — CID 89049260
methyl 1-[2-(2,2-dimethylmorpholin-4-yl)acetyl]aziridine-2-carboxylate (PubChem CID 89049260) has the molecular formula C12H20N2O4 and a molecular weight of 256.30 g/mol. Its IUPAC name is methyl 1-[2-(2,2-dimethylmorpholin-4-yl)acetyl]aziridine-2-carboxylate.
| Compound Name | methyl 1-[2-(2,2-dimethylmorpholin-4-yl)acetyl]aziridine-2-carboxylate |
|---|---|
| PubChem CID | 89049260 |
| Molecular Formula | C12H20N2O4 |
| Molecular Weight | 256.30 g/mol |
| Exact Mass | 256.14 |
| IUPAC Name | methyl 1-[2-(2,2-dimethylmorpholin-4-yl)acetyl]aziridine-2-carboxylate |
| SMILES | COC(=O)C1CN1C(=O)CN1CCOC(C)(C)C1 |
| InChI | InChI=1S/C12H20N2O4/c1-12(2)8-13(4-5-18-12)7-10(15)14-6-9(14)11(16)17-3/h9H,4-8H2,1-3H3 |
| InChIKey | YEJDMCPYMOWMEX-UHFFFAOYSA-N |
| XLogP | -0.52 |
| TPSA | 58.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.30 |
| LogP ≤ 5 | -0.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|