C9H18N2O2 — CID 130684724
2-(2,2-dimethyl-1,4-oxazepan-4-yl)acetamide (PubChem CID 130684724) has the molecular formula C9H18N2O2 and a molecular weight of 186.25 g/mol. Its IUPAC name is 2-(2,2-dimethyl-1,4-oxazepan-4-yl)acetamide.
| Compound Name | 2-(2,2-dimethyl-1,4-oxazepan-4-yl)acetamide |
|---|---|
| PubChem CID | 130684724 |
| Molecular Formula | C9H18N2O2 |
| Molecular Weight | 186.25 g/mol |
| Exact Mass | 186.14 |
| IUPAC Name | 2-(2,2-dimethyl-1,4-oxazepan-4-yl)acetamide |
| SMILES | CC1(C)CN(CC(N)=O)CCCO1 |
| InChI | InChI=1S/C9H18N2O2/c1-9(2)7-11(6-8(10)12)4-3-5-13-9/h3-7H2,1-2H3,(H2,10,12) |
| InChIKey | RZAPCDPMNMQDPS-UHFFFAOYSA-N |
| XLogP | -0.03 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.25 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |