C17H34N4 — CID 63898746
N-[(1,4-dimethylpiperazin-2-yl)methyl]-1-(3-methylbut-2-enyl)piperidin-4-amine (PubChem CID 63898746) has the molecular formula C17H34N4 and a molecular weight of 294.49 g/mol. Its IUPAC name is N-[(1,4-dimethylpiperazin-2-yl)methyl]-1-(3-methylbut-2-enyl)piperidin-4-amine.
| Compound Name | N-[(1,4-dimethylpiperazin-2-yl)methyl]-1-(3-methylbut-2-enyl)piperidin-4-amine |
|---|---|
| PubChem CID | 63898746 |
| Molecular Formula | C17H34N4 |
| Molecular Weight | 294.49 g/mol |
| Exact Mass | 294.28 |
| IUPAC Name | N-[(1,4-dimethylpiperazin-2-yl)methyl]-1-(3-methylbut-2-enyl)piperidin-4-amine |
| SMILES | CC(C)=CCN1CCC(NCC2CN(C)CCN2C)CC1 |
| InChI | InChI=1S/C17H34N4/c1-15(2)5-8-21-9-6-16(7-10-21)18-13-17-14-19(3)11-12-20(17)4/h5,16-18H,6-14H2,1-4H3 |
| InChIKey | TZVJLJAEBCIVES-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 21.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.49 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|