C21H34FN3 — CID 143280157
1-[1-[(2Z,4Z)-2-ethenyl-3-fluoro-5-methylhepta-2,4,6-trienyl]piperidin-4-yl]-2-ethylpiperazine (PubChem CID 143280157) has the molecular formula C21H34FN3 and a molecular weight of 347.52 g/mol. Its IUPAC name is 1-[1-[(2Z,4Z)-2-ethenyl-3-fluoro-5-methylhepta-2,4,6-trienyl]piperidin-4-yl]-2-ethylpiperazine.
| Compound Name | 1-[1-[(2Z,4Z)-2-ethenyl-3-fluoro-5-methylhepta-2,4,6-trienyl]piperidin-4-yl]-2-ethylpiperazine |
|---|---|
| PubChem CID | 143280157 |
| Molecular Formula | C21H34FN3 |
| Molecular Weight | 347.52 g/mol |
| Exact Mass | 347.27 |
| IUPAC Name | 1-[1-[(2Z,4Z)-2-ethenyl-3-fluoro-5-methylhepta-2,4,6-trienyl]piperidin-4-yl]-2-ethylpiperazine |
| SMILES | C=C/C(C)=C\C(F)=C(/C=C)CN1CCC(N2CCNCC2CC)CC1 |
| InChI | InChI=1S/C21H34FN3/c1-5-17(4)14-21(22)18(6-2)16-24-11-8-20(9-12-24)25-13-10-23-15-19(25)7-3/h5-6,14,19-20,23H,1-2,7-13,15-16H2,3-4H3/b17-14-,21-18- |
| InChIKey | DZVWQZFYRIIIRQ-AVOLQQPTSA-N |
| XLogP | 3.68 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.52 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|