C10H7N5OS — CID 63904423
4-[5-(thiadiazol-5-yl)-1,2,4-oxadiazol-3-yl]aniline (PubChem CID 63904423) has the molecular formula C10H7N5OS and a molecular weight of 245.27 g/mol. Its IUPAC name is 4-[5-(thiadiazol-5-yl)-1,2,4-oxadiazol-3-yl]aniline.
| Compound Name | 4-[5-(thiadiazol-5-yl)-1,2,4-oxadiazol-3-yl]aniline |
|---|---|
| PubChem CID | 63904423 |
| Molecular Formula | C10H7N5OS |
| Molecular Weight | 245.27 g/mol |
| Exact Mass | 245.04 |
| IUPAC Name | 4-[5-(thiadiazol-5-yl)-1,2,4-oxadiazol-3-yl]aniline |
| SMILES | Nc1ccc(-c2noc(-c3cnns3)n2)cc1 |
| InChI | InChI=1S/C10H7N5OS/c11-7-3-1-6(2-4-7)9-13-10(16-14-9)8-5-12-15-17-8/h1-5H,11H2 |
| InChIKey | KJMOYCHSDMWWOX-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 90.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.27 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|