C57H50OP2+2 — CID 6390562
[(E,2E)-2-benzylidene-4-oxo-7-phenyl-6-(triphenylphosphaniumylmethyl)hept-6-enyl]-triphenylphosphanium (PubChem CID 6390562) has the molecular formula C57H50OP2+2 and a molecular weight of 812.97 g/mol. Its IUPAC name is [(E,2E)-2-benzylidene-4-oxo-7-phenyl-6-(triphenylphosphaniumylmethyl)hept-6-enyl]-triphenylphosphanium.
| Compound Name | [(E,2E)-2-benzylidene-4-oxo-7-phenyl-6-(triphenylphosphaniumylmethyl)hept-6-enyl]-triphenylphosphanium |
|---|---|
| PubChem CID | 6390562 |
| Molecular Formula | C57H50OP2+2 |
| Molecular Weight | 812.97 g/mol |
| Exact Mass | 812.33 |
| IUPAC Name | [(E,2E)-2-benzylidene-4-oxo-7-phenyl-6-(triphenylphosphaniumylmethyl)hept-6-enyl]-triphenylphosphanium |
| SMILES | O=C(C/C(=C\c1ccccc1)C[P+](c1ccccc1)(c1ccccc1)c1ccccc1)C/C(=C\c1ccccc1)C[P+](c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C57H50OP2/c58-51(43-49(41-47-25-9-1-10-26-47)45-59(52-29-13-3-14-30-52,53-31-15-4-16-32-53)54-33-17-5-18-34-54)44-50(42-48-27-11-2-12-28-48)46-60(55-35-19-6-20-36-55,56-37-21-7-22-38-56)57-39-23-8-24-40-57/h1-42H,43-46H2/q+2/b49-41+,50-42+ |
| InChIKey | TZPYVXIPRUHANZ-NTHXEYRTSA-N |
| XLogP | 11.49 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 812.97 |
| LogP ≤ 5 | 11.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|