C15H22N4 — CID 63907936
2-cyclopropyl-2-(cyclopropylamino)-3-(2-propan-2-ylimidazol-1-yl)propanenitrile (PubChem CID 63907936) has the molecular formula C15H22N4 and a molecular weight of 258.37 g/mol. Its IUPAC name is 2-cyclopropyl-2-(cyclopropylamino)-3-(2-propan-2-ylimidazol-1-yl)propanenitrile.
| Compound Name | 2-cyclopropyl-2-(cyclopropylamino)-3-(2-propan-2-ylimidazol-1-yl)propanenitrile |
|---|---|
| PubChem CID | 63907936 |
| Molecular Formula | C15H22N4 |
| Molecular Weight | 258.37 g/mol |
| Exact Mass | 258.18 |
| IUPAC Name | 2-cyclopropyl-2-(cyclopropylamino)-3-(2-propan-2-ylimidazol-1-yl)propanenitrile |
| SMILES | CC(C)c1nccn1CC(C#N)(NC1CC1)C1CC1 |
| InChI | InChI=1S/C15H22N4/c1-11(2)14-17-7-8-19(14)10-15(9-16,12-3-4-12)18-13-5-6-13/h7-8,11-13,18H,3-6,10H2,1-2H3 |
| InChIKey | DTDBCRLTASIBEL-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 53.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.37 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |