C14H29N3O3 — CID 63911477
3-[bis(2-methoxyethyl)amino]-2-cyclopropyl-2-(ethylamino)propanamide (PubChem CID 63911477) has the molecular formula C14H29N3O3 and a molecular weight of 287.40 g/mol. Its IUPAC name is 3-[bis(2-methoxyethyl)amino]-2-cyclopropyl-2-(ethylamino)propanamide.
| Compound Name | 3-[bis(2-methoxyethyl)amino]-2-cyclopropyl-2-(ethylamino)propanamide |
|---|---|
| PubChem CID | 63911477 |
| Molecular Formula | C14H29N3O3 |
| Molecular Weight | 287.40 g/mol |
| Exact Mass | 287.22 |
| IUPAC Name | 3-[bis(2-methoxyethyl)amino]-2-cyclopropyl-2-(ethylamino)propanamide |
| SMILES | CCNC(CN(CCOC)CCOC)(C(N)=O)C1CC1 |
| InChI | InChI=1S/C14H29N3O3/c1-4-16-14(13(15)18,12-5-6-12)11-17(7-9-19-2)8-10-20-3/h12,16H,4-11H2,1-3H3,(H2,15,18) |
| InChIKey | PQGCHHMYFVTCBA-UHFFFAOYSA-N |
| XLogP | -0.18 |
| TPSA | 76.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.40 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |