C14H27N3O2 — CID 63913780
3-[bis(2-methoxyethyl)amino]-2-cyclopropyl-2-(ethylamino)propanenitrile (PubChem CID 63913780) has the molecular formula C14H27N3O2 and a molecular weight of 269.39 g/mol. Its IUPAC name is 3-[bis(2-methoxyethyl)amino]-2-cyclopropyl-2-(ethylamino)propanenitrile.
| Compound Name | 3-[bis(2-methoxyethyl)amino]-2-cyclopropyl-2-(ethylamino)propanenitrile |
|---|---|
| PubChem CID | 63913780 |
| Molecular Formula | C14H27N3O2 |
| Molecular Weight | 269.39 g/mol |
| Exact Mass | 269.21 |
| IUPAC Name | 3-[bis(2-methoxyethyl)amino]-2-cyclopropyl-2-(ethylamino)propanenitrile |
| SMILES | CCNC(C#N)(CN(CCOC)CCOC)C1CC1 |
| InChI | InChI=1S/C14H27N3O2/c1-4-16-14(11-15,13-5-6-13)12-17(7-9-18-2)8-10-19-3/h13,16H,4-10,12H2,1-3H3 |
| InChIKey | KLSVJNXDXIJTGT-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 57.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.39 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |