C11H16N2O2 — CID 63911769
(2,6-dimethylpiperazin-1-yl)-(furan-2-yl)methanone (PubChem CID 63911769) has the molecular formula C11H16N2O2 and a molecular weight of 208.26 g/mol. Its IUPAC name is (2,6-dimethylpiperazin-1-yl)-(furan-2-yl)methanone.
| Compound Name | (2,6-dimethylpiperazin-1-yl)-(furan-2-yl)methanone |
|---|---|
| PubChem CID | 63911769 |
| Molecular Formula | C11H16N2O2 |
| Molecular Weight | 208.26 g/mol |
| Exact Mass | 208.12 |
| IUPAC Name | (2,6-dimethylpiperazin-1-yl)-(furan-2-yl)methanone |
| SMILES | CC1CNCC(C)N1C(=O)c1ccco1 |
| InChI | InChI=1S/C11H16N2O2/c1-8-6-12-7-9(2)13(8)11(14)10-4-3-5-15-10/h3-5,8-9,12H,6-7H2,1-2H3 |
| InChIKey | NZFNYIQHJCXYEO-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 45.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.26 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |